About 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline
7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline (PubChem CID 11172030) has the molecular formula C11H10ClN3
and a molecular weight of 219.67 g/mol. Its IUPAC name is 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline.
Molecular Properties
| Compound Name | 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline |
| PubChem CID | 11172030 |
| Molecular Formula | C11H10ClN3 |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline |
| SMILES | C=C1c2cc(Cl)ccc2NC2=NCCN12 |
| InChI | InChI=1S/C11H10ClN3/c1-7-9-6-8(12)2-3-10(9)14-11-13-4-5-15(7)11/h2-3,6H,1,4-5H2,(H,13,14) |
| InChIKey | NCTXSKGUIPBFOX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline?
The IUPAC name of 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline (CID 11172030) is 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline.
What is the SMILES notation for 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline?
The canonical SMILES for 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline is C=C1c2cc(Cl)ccc2NC2=NCCN12.
What is the InChIKey of 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline?
The InChIKey is NCTXSKGUIPBFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3/c1-7-9-6-8(12)2-3-10(9)14-11-13-4-5-15(7)11/h2-3,6H,1,4-5H2,(H,13,14).
What are the key properties of 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline?
7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline has a molecular weight of 219.67 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-methylidene-3,10-dihydro-2H-imidazo[2,1-b]quinazoline is sourced from PubChem (CID 11172030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).