C19H24Cl2N4OS — CID 111720460
2-[[[3-(2,4-dichlorophenyl)propylamino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111720460) has the molecular formula C19H24Cl2N4OS and a molecular weight of 427.40 g/mol. Its IUPAC name is 2-[[[3-(2,4-dichlorophenyl)propylamino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[3-(2,4-dichlorophenyl)propylamino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111720460 |
| Molecular Formula | C19H24Cl2N4OS |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 2-[[[3-(2,4-dichlorophenyl)propylamino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NCCCc1ccc(Cl)cc1Cl)NCc1cccs1 |
| InChI | InChI=1S/C19H24Cl2N4OS/c1-25(2)18(26)13-24-19(23-12-16-6-4-10-27-16)22-9-3-5-14-7-8-15(20)11-17(14)21/h4,6-8,10-11H,3,5,9,12-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | ACPMKWJTCOFKKE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|