About 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid
3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid (PubChem CID 1117205) has the molecular formula C17H13N5O2S
and a molecular weight of 351.39 g/mol. Its IUPAC name is 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid.
Molecular Properties
| Compound Name | 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid |
| PubChem CID | 1117205 |
| Molecular Formula | C17H13N5O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid |
| SMILES | Cc1nc2ncccn2c1-c1csc(Nc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C17H13N5O2S/c1-10-14(22-7-3-6-18-16(22)19-10)13-9-25-17(21-13)20-12-5-2-4-11(8-12)15(23)24/h2-9H,1H3,(H,20,21)(H,23,24) |
| InChIKey | GVITWPARGHMYIB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid?
The IUPAC name of 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid (CID 1117205) is 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid.
What is the SMILES notation for 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid?
The canonical SMILES for 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid is Cc1nc2ncccn2c1-c1csc(Nc2cccc(C(=O)O)c2)n1.
What is the InChIKey of 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid?
The InChIKey is GVITWPARGHMYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5O2S/c1-10-14(22-7-3-6-18-16(22)19-10)13-9-25-17(21-13)20-12-5-2-4-11(8-12)15(23)24/h2-9H,1H3,(H,20,21)(H,23,24).
What are the key properties of 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid?
3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid has a molecular weight of 351.39 g/mol, XLogP of 3.60, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2-methylimidazo[1,2-a]pyrimidin-3-yl)-1,3-thiazol-2-yl]amino]benzoic acid is sourced from PubChem (CID 1117205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).