C22H26Cl2N6 — CID 111720510
2-benzyl-1-[3-(2,4-dichlorophenyl)propyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111720510) has the molecular formula C22H26Cl2N6 and a molecular weight of 445.40 g/mol. Its IUPAC name is 2-benzyl-1-[3-(2,4-dichlorophenyl)propyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 2-benzyl-1-[3-(2,4-dichlorophenyl)propyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111720510 |
| Molecular Formula | C22H26Cl2N6 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 2-benzyl-1-[3-(2,4-dichlorophenyl)propyl]-3-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | Cc1nnc(CN/C(=N\Cc2ccccc2)NCCCc2ccc(Cl)cc2Cl)n1C |
| InChI | InChI=1S/C22H26Cl2N6/c1-16-28-29-21(30(16)2)15-27-22(26-14-17-7-4-3-5-8-17)25-12-6-9-18-10-11-19(23)13-20(18)24/h3-5,7-8,10-11,13H,6,9,12,14-15H2,1-2H3,(H2,25,26,27) |
| InChIKey | IPYRHNACKYWWEM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|