C18H30IN3O — CID 111720784
2-[3-(2-methylpropoxy)propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide (PubChem CID 111720784) has the molecular formula C18H30IN3O and a molecular weight of 431.36 g/mol. Its IUPAC name is 2-[3-(2-methylpropoxy)propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide.
| Compound Name | 2-[3-(2-methylpropoxy)propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111720784 |
| Molecular Formula | C18H30IN3O |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-[3-(2-methylpropoxy)propyl]-1-(5,6,7,8-tetrahydronaphthalen-1-yl)guanidine;hydroiodide |
| SMILES | CC(C)COCCC/N=C(\N)Nc1cccc2c1CCCC2.I |
| InChI | InChI=1S/C18H29N3O.HI/c1-14(2)13-22-12-6-11-20-18(19)21-17-10-5-8-15-7-3-4-9-16(15)17;/h5,8,10,14H,3-4,6-7,9,11-13H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | YBZHXXQOFTWOPZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|