About [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol
[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol (PubChem CID 11172116) has the molecular formula C9H8F4O2
and a molecular weight of 224.15 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol |
| PubChem CID | 11172116 |
| Molecular Formula | C9H8F4O2 |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol |
| SMILES | COCc1c(F)c(F)c(CO)c(F)c1F |
| InChI | InChI=1S/C9H8F4O2/c1-15-3-5-8(12)6(10)4(2-14)7(11)9(5)13/h14H,2-3H2,1H3 |
| InChIKey | YFHZSPDQKWFAPH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol?
The IUPAC name of [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol (CID 11172116) is [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol.
What is the SMILES notation for [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol?
The canonical SMILES for [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol is COCc1c(F)c(F)c(CO)c(F)c1F.
What is the InChIKey of [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol?
The InChIKey is YFHZSPDQKWFAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F4O2/c1-15-3-5-8(12)6(10)4(2-14)7(11)9(5)13/h14H,2-3H2,1H3.
What are the key properties of [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol?
[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol has a molecular weight of 224.15 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methanol is sourced from PubChem (CID 11172116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).