About N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide
N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide (PubChem CID 1117212) has the molecular formula C19H17N5OS
and a molecular weight of 363.45 g/mol. Its IUPAC name is N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide |
| PubChem CID | 1117212 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(-c3c(C)nc4ccccn34)cs2)cc1 |
| InChI | InChI=1S/C19H17N5OS/c1-12-18(24-10-4-3-5-17(24)20-12)16-11-26-19(23-16)22-15-8-6-14(7-9-15)21-13(2)25/h3-11H,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | GQBDOCRWLJFEBR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide?
The IUPAC name of N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide (CID 1117212) is N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide.
What is the SMILES notation for N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide?
The canonical SMILES for N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide is CC(=O)Nc1ccc(Nc2nc(-c3c(C)nc4ccccn34)cs2)cc1.
What is the InChIKey of N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide?
The InChIKey is GQBDOCRWLJFEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5OS/c1-12-18(24-10-4-3-5-17(24)20-12)16-11-26-19(23-16)22-15-8-6-14(7-9-15)21-13(2)25/h3-11H,1-2H3,(H,21,25)(H,22,23).
What are the key properties of N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide?
N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide has a molecular weight of 363.45 g/mol, XLogP of 4.47, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]phenyl]acetamide is sourced from PubChem (CID 1117212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).