C17H23F3N4 — CID 111721499
1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111721499) has the molecular formula C17H23F3N4 and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111721499 |
| Molecular Formula | C17H23F3N4 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | N/C(=N\C1CCN(CC(F)(F)F)C1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C17H23F3N4/c18-17(19,20)11-24-9-8-13(10-24)22-16(21)23-15-7-3-5-12-4-1-2-6-14(12)15/h3,5,7,13H,1-2,4,6,8-11H2,(H3,21,22,23) |
| InChIKey | MIKOZVLAUAILCR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|