C11H24IN3O2S — CID 111722186
1,1,3,3-tetramethyl-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine;hydroiodide (PubChem CID 111722186) has the molecular formula C11H24IN3O2S and a molecular weight of 389.30 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine;hydroiodide.
| Compound Name | 1,1,3,3-tetramethyl-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111722186 |
| Molecular Formula | C11H24IN3O2S |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]guanidine;hydroiodide |
| SMILES | CN(C)C(=NCC1(CS(C)(=O)=O)CC1)N(C)C.I |
| InChI | InChI=1S/C11H23N3O2S.HI/c1-13(2)10(14(3)4)12-8-11(6-7-11)9-17(5,15)16;/h6-9H2,1-5H3;1H |
| InChIKey | PABRDDXGCWYETA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|