C20H29N5 — CID 111724857
3-benzyl-N'-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]pyrrolidine-1-carboximidamide (PubChem CID 111724857) has the molecular formula C20H29N5 and a molecular weight of 339.49 g/mol. Its IUPAC name is 3-benzyl-N'-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-benzyl-N'-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111724857 |
| Molecular Formula | C20H29N5 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 3-benzyl-N'-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCn1cc(C)cn1)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H29N5/c1-17-14-23-25(15-17)11-6-10-22-20(21-2)24-12-9-19(16-24)13-18-7-4-3-5-8-18/h3-5,7-8,14-15,19H,6,9-13,16H2,1-2H3,(H,21,22) |
| InChIKey | RFMVDEZNHZGSMP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|