C24H33N3O3 — CID 111724939
3-benzyl-N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 111724939) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 3-benzyl-N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-benzyl-N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111724939 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 3-benzyl-N-ethyl-N'-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H33N3O3/c1-5-25-24(27-12-11-19(17-27)13-18-9-7-6-8-10-18)26-16-20-14-21(28-2)23(30-4)22(15-20)29-3/h6-10,14-15,19H,5,11-13,16-17H2,1-4H3,(H,25,26) |
| InChIKey | XEMFUOMQNLGKIH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|