C23H28N4O — CID 111725301
3-benzyl-N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111725301) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-benzyl-N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | 3-benzyl-N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111725301 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 3-benzyl-N-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC(=O)N1CCc2ccccc21)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H28N4O/c1-24-23(26-13-11-19(17-26)15-18-7-3-2-4-8-18)25-16-22(28)27-14-12-20-9-5-6-10-21(20)27/h2-10,19H,11-17H2,1H3,(H,24,25) |
| InChIKey | YLOHLEIIDWSRHK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|