About trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane
trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane (PubChem CID 11172557) has the molecular formula C13H26O2Si
and a molecular weight of 242.43 g/mol. Its IUPAC name is trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane.
Molecular Properties
| Compound Name | trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane |
| PubChem CID | 11172557 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane |
| SMILES | C=CC[C@@H]1O[C@@H](OCC[Si](C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C13H26O2Si/c1-6-7-12-11(2)10-13(15-12)14-8-9-16(3,4)5/h6,11-13H,1,7-10H2,2-5H3/t11-,12-,13+/m0/s1 |
| InChIKey | IXILLNFVZCQKQF-RWMBFGLXSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane?
The IUPAC name of trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane (CID 11172557) is trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane.
What is the SMILES notation for trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane?
The canonical SMILES for trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane is C=CC[C@@H]1O[C@@H](OCC[Si](C)(C)C)C[C@@H]1C.
What is the InChIKey of trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane?
The InChIKey is IXILLNFVZCQKQF-RWMBFGLXSA-N. The full InChI is InChI=1S/C13H26O2Si/c1-6-7-12-11(2)10-13(15-12)14-8-9-16(3,4)5/h6,11-13H,1,7-10H2,2-5H3/t11-,12-,13+/m0/s1.
What are the key properties of trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane?
trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane has a molecular weight of 242.43 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]oxyethyl]silane is sourced from PubChem (CID 11172557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).