C21H32N4O — CID 111725623
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-benzyl-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111725623) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-benzyl-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-benzyl-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111725623 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-benzyl-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CN2CCCC2CO1)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H32N4O/c1-22-21(23-13-20-15-24-10-5-8-19(24)16-26-20)25-11-9-18(14-25)12-17-6-3-2-4-7-17/h2-4,6-7,18-20H,5,8-16H2,1H3,(H,22,23) |
| InChIKey | WHAQRVWUVLCWKE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|