About (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane
(5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane (PubChem CID 11172611) has the molecular formula C13H25FOSi
and a molecular weight of 244.43 g/mol. Its IUPAC name is (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane |
| PubChem CID | 11172611 |
| Molecular Formula | C13H25FOSi |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C1=CC(F)OC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C13H25FOSi/c1-9(2)16(10(3)4,11(5)6)12-7-13(14)15-8-12/h7,9-11,13H,8H2,1-6H3 |
| InChIKey | QISQEDRIZCXDBK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane?
The IUPAC name of (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane (CID 11172611) is (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane.
What is the SMILES notation for (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane?
The canonical SMILES for (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane is CC(C)[Si](C1=CC(F)OC1)(C(C)C)C(C)C.
What is the InChIKey of (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane?
The InChIKey is QISQEDRIZCXDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25FOSi/c1-9(2)16(10(3)4,11(5)6)12-7-13(14)15-8-12/h7,9-11,13H,8H2,1-6H3.
What are the key properties of (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane?
(5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane has a molecular weight of 244.43 g/mol, XLogP of 4.46, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2,5-dihydrofuran-3-yl)-tri(propan-2-yl)silane is sourced from PubChem (CID 11172611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).