About 2-chloro-6-(1,3-dioxan-2-yl)quinoline
2-chloro-6-(1,3-dioxan-2-yl)quinoline (PubChem CID 11172728) has the molecular formula C13H12ClNO2
and a molecular weight of 249.70 g/mol. Its IUPAC name is 2-chloro-6-(1,3-dioxan-2-yl)quinoline.
Molecular Properties
| Compound Name | 2-chloro-6-(1,3-dioxan-2-yl)quinoline |
| PubChem CID | 11172728 |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-chloro-6-(1,3-dioxan-2-yl)quinoline |
| SMILES | Clc1ccc2cc(C3OCCCO3)ccc2n1 |
| InChI | InChI=1S/C13H12ClNO2/c14-12-5-3-9-8-10(2-4-11(9)15-12)13-16-6-1-7-17-13/h2-5,8,13H,1,6-7H2 |
| InChIKey | ZEORDGDTJSAXRK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-(1,3-dioxan-2-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(1,3-dioxan-2-yl)quinoline?
The IUPAC name of 2-chloro-6-(1,3-dioxan-2-yl)quinoline (CID 11172728) is 2-chloro-6-(1,3-dioxan-2-yl)quinoline.
What is the SMILES notation for 2-chloro-6-(1,3-dioxan-2-yl)quinoline?
The canonical SMILES for 2-chloro-6-(1,3-dioxan-2-yl)quinoline is Clc1ccc2cc(C3OCCCO3)ccc2n1.
What is the InChIKey of 2-chloro-6-(1,3-dioxan-2-yl)quinoline?
The InChIKey is ZEORDGDTJSAXRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO2/c14-12-5-3-9-8-10(2-4-11(9)15-12)13-16-6-1-7-17-13/h2-5,8,13H,1,6-7H2.
What are the key properties of 2-chloro-6-(1,3-dioxan-2-yl)quinoline?
2-chloro-6-(1,3-dioxan-2-yl)quinoline has a molecular weight of 249.70 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(1,3-dioxan-2-yl)quinoline is sourced from PubChem (CID 11172728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).