C18H28IN5O2 — CID 111727410
2-[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]-N-phenylacetamide;hydroiodide (PubChem CID 111727410) has the molecular formula C18H28IN5O2 and a molecular weight of 473.36 g/mol. Its IUPAC name is 2-[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]-N-phenylacetamide;hydroiodide.
| Compound Name | 2-[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]-N-phenylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111727410 |
| Molecular Formula | C18H28IN5O2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]-N-phenylacetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)Nc1ccccc1)N1CCC(N2CCOCC2)C1.I |
| InChI | InChI=1S/C18H27N5O2.HI/c1-19-18(20-13-17(24)21-15-5-3-2-4-6-15)23-8-7-16(14-23)22-9-11-25-12-10-22;/h2-6,16H,7-14H2,1H3,(H,19,20)(H,21,24);1H |
| InChIKey | KEADBIQWQBXZFK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|