C16H30N4O3 — CID 111727507
ethyl 4-[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]butanoate (PubChem CID 111727507) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is ethyl 4-[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]butanoate.
| Compound Name | ethyl 4-[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 111727507 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | ethyl 4-[[N-methyl-C-(3-morpholin-4-ylpyrrolidin-1-yl)carbonimidoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCN/C(=N\C)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C16H30N4O3/c1-3-23-15(21)5-4-7-18-16(17-2)20-8-6-14(13-20)19-9-11-22-12-10-19/h14H,3-13H2,1-2H3,(H,17,18) |
| InChIKey | KEWYPKMGXRBSJT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|