About N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine
N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine (PubChem CID 11172780) has the molecular formula C10H21NS3
and a molecular weight of 251.49 g/mol. Its IUPAC name is N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine |
| PubChem CID | 11172780 |
| Molecular Formula | C10H21NS3 |
| Molecular Weight | 251.49 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine |
| SMILES | CCN(CC)CC(SC)=C(SC)SC |
| InChI | InChI=1S/C10H21NS3/c1-6-11(7-2)8-9(12-3)10(13-4)14-5/h6-8H2,1-5H3 |
| InChIKey | RFUQFAIDMXPABF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine?
The IUPAC name of N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine (CID 11172780) is N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine.
What is the SMILES notation for N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine?
The canonical SMILES for N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine is CCN(CC)CC(SC)=C(SC)SC.
What is the InChIKey of N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine?
The InChIKey is RFUQFAIDMXPABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NS3/c1-6-11(7-2)8-9(12-3)10(13-4)14-5/h6-8H2,1-5H3.
What are the key properties of N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine?
N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine has a molecular weight of 251.49 g/mol, XLogP of 3.59, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2,3,3-tris(methylsulfanyl)prop-2-en-1-amine is sourced from PubChem (CID 11172780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).