About N-(4-bromophenyl)-2,2,2-trifluoroethanimine
N-(4-bromophenyl)-2,2,2-trifluoroethanimine (PubChem CID 11172782) has the molecular formula C8H5BrF3N
and a molecular weight of 252.03 g/mol. Its IUPAC name is N-(4-bromophenyl)-2,2,2-trifluoroethanimine.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-2,2,2-trifluoroethanimine |
| PubChem CID | 11172782 |
| Molecular Formula | C8H5BrF3N |
| Molecular Weight | 252.03 g/mol |
| Exact Mass | 250.96 |
| IUPAC Name | N-(4-bromophenyl)-2,2,2-trifluoroethanimine |
| SMILES | FC(F)(F)/C=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C8H5BrF3N/c9-6-1-3-7(4-2-6)13-5-8(10,11)12/h1-5H/b13-5+ |
| InChIKey | LCYQAWWRSVBGIX-WLRTZDKTSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.03 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromophenyl)-2,2,2-trifluoroethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-2,2,2-trifluoroethanimine?
The IUPAC name of N-(4-bromophenyl)-2,2,2-trifluoroethanimine (CID 11172782) is N-(4-bromophenyl)-2,2,2-trifluoroethanimine.
What is the SMILES notation for N-(4-bromophenyl)-2,2,2-trifluoroethanimine?
The canonical SMILES for N-(4-bromophenyl)-2,2,2-trifluoroethanimine is FC(F)(F)/C=N/c1ccc(Br)cc1.
What is the InChIKey of N-(4-bromophenyl)-2,2,2-trifluoroethanimine?
The InChIKey is LCYQAWWRSVBGIX-WLRTZDKTSA-N. The full InChI is InChI=1S/C8H5BrF3N/c9-6-1-3-7(4-2-6)13-5-8(10,11)12/h1-5H/b13-5+.
What are the key properties of N-(4-bromophenyl)-2,2,2-trifluoroethanimine?
N-(4-bromophenyl)-2,2,2-trifluoroethanimine has a molecular weight of 252.03 g/mol, XLogP of 3.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-2,2,2-trifluoroethanimine is sourced from PubChem (CID 11172782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).