C23H40IN5O2 — CID 111727932
N-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]-N'-methyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111727932) has the molecular formula C23H40IN5O2 and a molecular weight of 545.51 g/mol. Its IUPAC name is N-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]-N'-methyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]-N'-methyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111727932 |
| Molecular Formula | C23H40IN5O2 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | N-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]-N'-methyl-3-morpholin-4-ylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN(CC)CCOc1ccccc1CN/C(=N/C)N1CCC(N2CCOCC2)C1.I |
| InChI | InChI=1S/C23H39N5O2.HI/c1-4-26(5-2)12-17-30-22-9-7-6-8-20(22)18-25-23(24-3)28-11-10-21(19-28)27-13-15-29-16-14-27;/h6-9,21H,4-5,10-19H2,1-3H3,(H,24,25);1H |
| InChIKey | GKJFLUHILKPMQM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|