C12H15NO5 — CID 11172812
[(1S,2R,8aR)-2-acetyloxy-3-oxo-2,5,8,8a-tetrahydro-1H-indolizin-1-yl] acetate (PubChem CID 11172812) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is [(1S,2R,8aR)-2-acetyloxy-3-oxo-2,5,8,8a-tetrahydro-1H-indolizin-1-yl] acetate.
| Compound Name | [(1S,2R,8aR)-2-acetyloxy-3-oxo-2,5,8,8a-tetrahydro-1H-indolizin-1-yl] acetate |
|---|---|
| PubChem CID | 11172812 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [(1S,2R,8aR)-2-acetyloxy-3-oxo-2,5,8,8a-tetrahydro-1H-indolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2CC=CCN2C(=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H15NO5/c1-7(14)17-10-9-5-3-4-6-13(9)12(16)11(10)18-8(2)15/h3-4,9-11H,5-6H2,1-2H3/t9-,10+,11-/m1/s1 |
| InChIKey | RXEHANCNDAFWLA-OUAUKWLOSA-N |
| XLogP | 0.02 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|