About trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one
trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one (PubChem CID 11172837) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one |
| PubChem CID | 11172837 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one |
| SMILES | C/C=C/[C@H]1CCCC(=O)[C@@H]1CCCC(OC)OC |
| InChI | InChI=1S/C15H26O3/c1-4-7-12-8-5-10-14(16)13(12)9-6-11-15(17-2)18-3/h4,7,12-13,15H,5-6,8-11H2,1-3H3/b7-4+/t12-,13+/m0/s1 |
| InChIKey | UTTKJBZQGDKMKJ-KVOPJGFESA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one?
The IUPAC name of trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one (CID 11172837) is trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one.
What is the SMILES notation for trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one?
The canonical SMILES for trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one is C/C=C/[C@H]1CCCC(=O)[C@@H]1CCCC(OC)OC.
What is the InChIKey of trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one?
The InChIKey is UTTKJBZQGDKMKJ-KVOPJGFESA-N. The full InChI is InChI=1S/C15H26O3/c1-4-7-12-8-5-10-14(16)13(12)9-6-11-15(17-2)18-3/h4,7,12-13,15H,5-6,8-11H2,1-3H3/b7-4+/t12-,13+/m0/s1.
What are the key properties of trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one?
trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one has a molecular weight of 254.37 g/mol, XLogP of 3.34, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,3R)-2-(4,4-dimethoxybutyl)-3-[(E)-prop-1-enyl]cyclohexan-1-one is sourced from PubChem (CID 11172837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).