About (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal
(E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal (PubChem CID 11172840) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal.
Molecular Properties
| Compound Name | (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal |
| PubChem CID | 11172840 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal |
| SMILES | C/C(C=O)=C\CC[C@@H](C)CCOC1CCCCO1 |
| InChI | InChI=1S/C15H26O3/c1-13(6-5-7-14(2)12-16)9-11-18-15-8-3-4-10-17-15/h7,12-13,15H,3-6,8-11H2,1-2H3/b14-7+/t13-,15?/m1/s1 |
| InChIKey | QKRUGVBUADUJKT-STZNCYHISA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal?
The IUPAC name of (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal (CID 11172840) is (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal.
What is the SMILES notation for (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal?
The canonical SMILES for (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal is C/C(C=O)=C\CC[C@@H](C)CCOC1CCCCO1.
What is the InChIKey of (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal?
The InChIKey is QKRUGVBUADUJKT-STZNCYHISA-N. The full InChI is InChI=1S/C15H26O3/c1-13(6-5-7-14(2)12-16)9-11-18-15-8-3-4-10-17-15/h7,12-13,15H,3-6,8-11H2,1-2H3/b14-7+/t13-,15?/m1/s1.
What are the key properties of (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal?
(E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal has a molecular weight of 254.37 g/mol, XLogP of 3.48, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,6R)-2,6-dimethyl-8-(oxan-2-yloxy)oct-2-enal is sourced from PubChem (CID 11172840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).