C19H33N7O2 — CID 111730719
tert-butyl N-[1-[N-ethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111730719) has the molecular formula C19H33N7O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is tert-butyl N-[1-[N-ethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N-ethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111730719 |
| Molecular Formula | C19H33N7O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | tert-butyl N-[1-[N-ethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H33N7O2/c1-5-20-17(21-12-16-24-23-15-8-6-7-10-26(15)16)25-11-9-14(13-25)22-18(27)28-19(2,3)4/h14H,5-13H2,1-4H3,(H,20,21)(H,22,27) |
| InChIKey | JNPGYDFKANTHQE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|