C16H29NO2 — CID 11173191
(1S,2S,8aS)-1,2-bis[(2-methylpropan-2-yl)oxy]-1,2,3,5,6,8a-hexahydroindolizine (PubChem CID 11173191) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is (1S,2S,8aS)-1,2-bis[(2-methylpropan-2-yl)oxy]-1,2,3,5,6,8a-hexahydroindolizine.
| Compound Name | (1S,2S,8aS)-1,2-bis[(2-methylpropan-2-yl)oxy]-1,2,3,5,6,8a-hexahydroindolizine |
|---|---|
| PubChem CID | 11173191 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | (1S,2S,8aS)-1,2-bis[(2-methylpropan-2-yl)oxy]-1,2,3,5,6,8a-hexahydroindolizine |
| SMILES | CC(C)(C)O[C@@H]1[C@@H](OC(C)(C)C)CN2CCC=C[C@@H]12 |
| InChI | InChI=1S/C16H29NO2/c1-15(2,3)18-13-11-17-10-8-7-9-12(17)14(13)19-16(4,5)6/h7,9,12-14H,8,10-11H2,1-6H3/t12-,13-,14-/m0/s1 |
| InChIKey | UZVCLEKDCPHOBC-IHRRRGAJSA-N |
| XLogP | 3.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|