C25H41IN4O2 — CID 111732796
N'-methyl-N-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide (PubChem CID 111732796) has the molecular formula C25H41IN4O2 and a molecular weight of 556.53 g/mol. Its IUPAC name is N'-methyl-N-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111732796 |
| Molecular Formula | C25H41IN4O2 |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | N'-methyl-N-[[3-[2-[methyl(oxan-4-yl)amino]ethoxy]phenyl]methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OCCN(C)C2CCOCC2)c1)N1CCC2(CCCC2)C1.I |
| InChI | InChI=1S/C25H40N4O2.HI/c1-26-24(29-13-12-25(20-29)10-3-4-11-25)27-19-21-6-5-7-23(18-21)31-17-14-28(2)22-8-15-30-16-9-22;/h5-7,18,22H,3-4,8-17,19-20H2,1-2H3,(H,26,27);1H |
| InChIKey | VFWPJOVSZJKAOL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|