C14H24O5 — CID 11173324
(1R)-1-[(2S,4aS,6R,8aR)-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]ethane-1,2-diol (PubChem CID 11173324) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (1R)-1-[(2S,4aS,6R,8aR)-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S,4aS,6R,8aR)-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 11173324 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (1R)-1-[(2S,4aS,6R,8aR)-2,6-dimethyl-6-[(2S)-oxiran-2-yl]-3,4,4a,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]ethane-1,2-diol |
| SMILES | C[C@]1([C@@H]2CO2)CC[C@H]2O[C@](C)([C@H](O)CO)CC[C@@H]2O1 |
| InChI | InChI=1S/C14H24O5/c1-13(11(16)7-15)5-3-10-9(18-13)4-6-14(2,19-10)12-8-17-12/h9-12,15-16H,3-8H2,1-2H3/t9-,10+,11-,12+,13+,14-/m1/s1 |
| InChIKey | QGWWKXGYLZNQNC-QTJJRWQNSA-N |
| XLogP | 0.61 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|