About [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate
[4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate (PubChem CID 11173382) has the molecular formula C16H12F2O2
and a molecular weight of 274.27 g/mol. Its IUPAC name is [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate |
| PubChem CID | 11173382 |
| Molecular Formula | C16H12F2O2 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C/c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C16H12F2O2/c1-11(19)20-16-6-4-12(5-7-16)2-3-13-8-14(17)10-15(18)9-13/h2-10H,1H3/b3-2+ |
| InChIKey | DZZTWCXKYNKNQY-NSCUHMNNSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate?
The IUPAC name of [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate (CID 11173382) is [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate.
What is the SMILES notation for [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate?
The canonical SMILES for [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate is CC(=O)Oc1ccc(/C=C/c2cc(F)cc(F)c2)cc1.
What is the InChIKey of [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate?
The InChIKey is DZZTWCXKYNKNQY-NSCUHMNNSA-N. The full InChI is InChI=1S/C16H12F2O2/c1-11(19)20-16-6-4-12(5-7-16)2-3-13-8-14(17)10-15(18)9-13/h2-10H,1H3/b3-2+.
What are the key properties of [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate?
[4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate has a molecular weight of 274.27 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenyl] acetate is sourced from PubChem (CID 11173382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).