About N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine
N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine (PubChem CID 11173508) has the molecular formula C15H19ClN2O
and a molecular weight of 278.78 g/mol. Its IUPAC name is N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine.
Molecular Properties
| Compound Name | N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine |
| PubChem CID | 11173508 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc2ccc(C)c(C)c2nc1Cl |
| InChI | InChI=1S/C15H19ClN2O/c1-10-4-5-12-8-13(9-17-6-7-19-3)15(16)18-14(12)11(10)2/h4-5,8,17H,6-7,9H2,1-3H3 |
| InChIKey | YNAHNHKMABFOGT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine?
The IUPAC name of N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine (CID 11173508) is N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine.
What is the SMILES notation for N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine?
The canonical SMILES for N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine is COCCNCc1cc2ccc(C)c(C)c2nc1Cl.
What is the InChIKey of N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine?
The InChIKey is YNAHNHKMABFOGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN2O/c1-10-4-5-12-8-13(9-17-6-7-19-3)15(16)18-14(12)11(10)2/h4-5,8,17H,6-7,9H2,1-3H3.
What are the key properties of N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine?
N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine has a molecular weight of 278.78 g/mol, XLogP of 3.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-2-methoxyethanamine is sourced from PubChem (CID 11173508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).