C13H22IN3OS — CID 111736406
3-(methoxymethyl)-N'-methyl-N-(thiophen-3-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111736406) has the molecular formula C13H22IN3OS and a molecular weight of 395.31 g/mol. Its IUPAC name is 3-(methoxymethyl)-N'-methyl-N-(thiophen-3-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(methoxymethyl)-N'-methyl-N-(thiophen-3-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111736406 |
| Molecular Formula | C13H22IN3OS |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 3-(methoxymethyl)-N'-methyl-N-(thiophen-3-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccsc1)N1CCC(COC)C1.I |
| InChI | InChI=1S/C13H21N3OS.HI/c1-14-13(15-7-11-4-6-18-10-11)16-5-3-12(8-16)9-17-2;/h4,6,10,12H,3,5,7-9H2,1-2H3,(H,14,15);1H |
| InChIKey | SWUAZUXGXRWSQA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|