C11H18Cl2O4 — CID 11173654
3,9-bis(2-chloroethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane (PubChem CID 11173654) has the molecular formula C11H18Cl2O4 and a molecular weight of 285.17 g/mol. Its IUPAC name is 3,9-bis(2-chloroethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane.
| Compound Name | 3,9-bis(2-chloroethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 11173654 |
| Molecular Formula | C11H18Cl2O4 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3,9-bis(2-chloroethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
| SMILES | ClCCC1OCC2(CO1)COC(CCCl)OC2 |
| InChI | InChI=1S/C11H18Cl2O4/c12-3-1-9-14-5-11(6-15-9)7-16-10(2-4-13)17-8-11/h9-10H,1-8H2 |
| InChIKey | VYJWNUDGXASHSF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|