C12H26IN3O2 — CID 111736890
N-ethyl-N'-(2-methoxyethyl)-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111736890) has the molecular formula C12H26IN3O2 and a molecular weight of 371.26 g/mol. Its IUPAC name is N-ethyl-N'-(2-methoxyethyl)-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-methoxyethyl)-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111736890 |
| Molecular Formula | C12H26IN3O2 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-ethyl-N'-(2-methoxyethyl)-3-(methoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCOC)N1CCC(COC)C1.I |
| InChI | InChI=1S/C12H25N3O2.HI/c1-4-13-12(14-6-8-16-2)15-7-5-11(9-15)10-17-3;/h11H,4-10H2,1-3H3,(H,13,14);1H |
| InChIKey | AJNOKIKRKLKTPU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|