C21H27ClIN3O — CID 111737048
N-[[2-(4-chlorophenyl)phenyl]methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111737048) has the molecular formula C21H27ClIN3O and a molecular weight of 499.82 g/mol. Its IUPAC name is N-[[2-(4-chlorophenyl)phenyl]methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[2-(4-chlorophenyl)phenyl]methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111737048 |
| Molecular Formula | C21H27ClIN3O |
| Molecular Weight | 499.82 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-[[2-(4-chlorophenyl)phenyl]methyl]-3-(methoxymethyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1-c1ccc(Cl)cc1)N1CCC(COC)C1.I |
| InChI | InChI=1S/C21H26ClN3O.HI/c1-23-21(25-12-11-16(14-25)15-26-2)24-13-18-5-3-4-6-20(18)17-7-9-19(22)10-8-17;/h3-10,16H,11-15H2,1-2H3,(H,23,24);1H |
| InChIKey | HBOCJUAICXVYMI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|