C15H27FO2Si — CID 11173706
(2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]ethanol (PubChem CID 11173706) has the molecular formula C15H27FO2Si and a molecular weight of 286.46 g/mol. Its IUPAC name is (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]ethanol.
| Compound Name | (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]ethanol |
|---|---|
| PubChem CID | 11173706 |
| Molecular Formula | C15H27FO2Si |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2Z)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexylidene]ethanol |
| SMILES | C=C1/C(=C\CO)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C15H27FO2Si/c1-11-12(7-8-17)9-13(10-14(11)16)18-19(5,6)15(2,3)4/h7,13-14,17H,1,8-10H2,2-6H3/b12-7-/t13-,14+/m1/s1 |
| InChIKey | UNZOGRGDTQTDIX-SADRXWBLSA-N |
| XLogP | 3.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|