C22H37IN4O2 — CID 111737452
3-(methoxymethyl)-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111737452) has the molecular formula C22H37IN4O2 and a molecular weight of 516.47 g/mol. Its IUPAC name is 3-(methoxymethyl)-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(methoxymethyl)-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111737452 |
| Molecular Formula | C22H37IN4O2 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 3-(methoxymethyl)-N-[2-(2-methoxyphenyl)-2-piperidin-1-ylethyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCC(c1ccccc1OC)N1CCCCC1)N1CCC(COC)C1.I |
| InChI | InChI=1S/C22H36N4O2.HI/c1-23-22(26-14-11-18(16-26)17-27-2)24-15-20(25-12-7-4-8-13-25)19-9-5-6-10-21(19)28-3;/h5-6,9-10,18,20H,4,7-8,11-17H2,1-3H3,(H,23,24);1H |
| InChIKey | NNTODTZHYXIOTQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|