C13H23N5 — CID 111739396
N-(2-imidazol-1-ylethyl)-N',3,3-trimethylpyrrolidine-1-carboximidamide (PubChem CID 111739396) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(2-imidazol-1-ylethyl)-N',3,3-trimethylpyrrolidine-1-carboximidamide.
| Compound Name | N-(2-imidazol-1-ylethyl)-N',3,3-trimethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111739396 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | N-(2-imidazol-1-ylethyl)-N',3,3-trimethylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCn1ccnc1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C13H23N5/c1-13(2)4-7-18(10-13)12(14-3)16-6-9-17-8-5-15-11-17/h5,8,11H,4,6-7,9-10H2,1-3H3,(H,14,16) |
| InChIKey | OYRUGWBFSBNWGI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|