About N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine
N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine (PubChem CID 11173955) has the molecular formula C17H17N3S
and a molecular weight of 295.41 g/mol. Its IUPAC name is N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine.
Molecular Properties
| Compound Name | N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine |
| PubChem CID | 11173955 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine |
| SMILES | C/N=c1\nc(-c2ccc(C)cc2)n(-c2ccc(C)cc2)s1 |
| InChI | InChI=1S/C17H17N3S/c1-12-4-8-14(9-5-12)16-19-17(18-3)21-20(16)15-10-6-13(2)7-11-15/h4-11H,1-3H3/b18-17+ |
| InChIKey | OGBISNNRLFTGHQ-ISLYRVAYSA-N |
| XLogP | 3.75 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine?
The IUPAC name of N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine (CID 11173955) is N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine.
What is the SMILES notation for N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine?
The canonical SMILES for N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine is C/N=c1\nc(-c2ccc(C)cc2)n(-c2ccc(C)cc2)s1.
What is the InChIKey of N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine?
The InChIKey is OGBISNNRLFTGHQ-ISLYRVAYSA-N. The full InChI is InChI=1S/C17H17N3S/c1-12-4-8-14(9-5-12)16-19-17(18-3)21-20(16)15-10-6-13(2)7-11-15/h4-11H,1-3H3/b18-17+.
What are the key properties of N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine?
N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine has a molecular weight of 295.41 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2,3-bis(4-methylphenyl)-1,2,4-thiadiazol-5-imine is sourced from PubChem (CID 11173955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).