C20H28N2 — CID 11173982
4,8b-bis(3-methylbut-2-enyl)-1,2,3,3a-tetrahydropyrrolo[2,3-b]indole (PubChem CID 11173982) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 4,8b-bis(3-methylbut-2-enyl)-1,2,3,3a-tetrahydropyrrolo[2,3-b]indole.
| Compound Name | 4,8b-bis(3-methylbut-2-enyl)-1,2,3,3a-tetrahydropyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 11173982 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 4,8b-bis(3-methylbut-2-enyl)-1,2,3,3a-tetrahydropyrrolo[2,3-b]indole |
| SMILES | CC(C)=CCN1c2ccccc2C2(CC=C(C)C)CCNC12 |
| InChI | InChI=1S/C20H28N2/c1-15(2)9-11-20-12-13-21-19(20)22(14-10-16(3)4)18-8-6-5-7-17(18)20/h5-10,19,21H,11-14H2,1-4H3 |
| InChIKey | TWRZIFGLJFJQJK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|