C15H30F3IN4 — CID 111739855
N-ethyl-3,3-dimethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111739855) has the molecular formula C15H30F3IN4 and a molecular weight of 450.33 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-3,3-dimethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111739855 |
| Molecular Formula | C15H30F3IN4 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-ethyl-3,3-dimethyl-N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)CC(F)(F)F)N1CCC(C)(C)C1.I |
| InChI | InChI=1S/C15H29F3N4.HI/c1-5-19-13(22-10-7-14(2,3)11-22)20-8-6-9-21(4)12-15(16,17)18;/h5-12H2,1-4H3,(H,19,20);1H |
| InChIKey | ZIPCSLRDXADVMZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|