C17H30O4 — CID 11174033
methyl 2-[(3R,6S)-4,6-diethyl-6-hexyl-3H-1,2-dioxin-3-yl]acetate (PubChem CID 11174033) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is methyl 2-[(3R,6S)-4,6-diethyl-6-hexyl-3H-1,2-dioxin-3-yl]acetate.
| Compound Name | methyl 2-[(3R,6S)-4,6-diethyl-6-hexyl-3H-1,2-dioxin-3-yl]acetate |
|---|---|
| PubChem CID | 11174033 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | methyl 2-[(3R,6S)-4,6-diethyl-6-hexyl-3H-1,2-dioxin-3-yl]acetate |
| SMILES | CCCCCC[C@@]1(CC)C=C(CC)[C@@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C17H30O4/c1-5-8-9-10-11-17(7-3)13-14(6-2)15(20-21-17)12-16(18)19-4/h13,15H,5-12H2,1-4H3/t15-,17+/m1/s1 |
| InChIKey | DVGHMGSERXEMNQ-WBVHZDCISA-N |
| XLogP | 4.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|