C14H28O3Si2 — CID 11174100
[(1E,3E,5Z)-1-methoxy-5-trimethylsilyloxyhepta-1,3,5-trienoxy]-trimethylsilane (PubChem CID 11174100) has the molecular formula C14H28O3Si2 and a molecular weight of 300.55 g/mol. Its IUPAC name is [(1E,3E,5Z)-1-methoxy-5-trimethylsilyloxyhepta-1,3,5-trienoxy]-trimethylsilane.
| Compound Name | [(1E,3E,5Z)-1-methoxy-5-trimethylsilyloxyhepta-1,3,5-trienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11174100 |
| Molecular Formula | C14H28O3Si2 |
| Molecular Weight | 300.55 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(1E,3E,5Z)-1-methoxy-5-trimethylsilyloxyhepta-1,3,5-trienoxy]-trimethylsilane |
| SMILES | C/C=C(/C=C/C=C(\OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H28O3Si2/c1-9-13(16-18(3,4)5)11-10-12-14(15-2)17-19(6,7)8/h9-12H,1-8H3/b11-10+,13-9-,14-12+ |
| InChIKey | HSAZJZDKJHPRIH-UAHFUDJNSA-N |
| XLogP | 4.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|