C17H23NO2Si — CID 11174126
4-[[(10R)-10,11-dihydroxyundeca-1,6,8-triynyl]-dimethylsilyl]butanenitrile (PubChem CID 11174126) has the molecular formula C17H23NO2Si and a molecular weight of 301.46 g/mol. Its IUPAC name is 4-[[(10R)-10,11-dihydroxyundeca-1,6,8-triynyl]-dimethylsilyl]butanenitrile.
| Compound Name | 4-[[(10R)-10,11-dihydroxyundeca-1,6,8-triynyl]-dimethylsilyl]butanenitrile |
|---|---|
| PubChem CID | 11174126 |
| Molecular Formula | C17H23NO2Si |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-[[(10R)-10,11-dihydroxyundeca-1,6,8-triynyl]-dimethylsilyl]butanenitrile |
| SMILES | C[Si](C)(C#CCCCC#CC#C[C@@H](O)CO)CCCC#N |
| InChI | InChI=1S/C17H23NO2Si/c1-21(2,15-11-9-13-18)14-10-7-5-3-4-6-8-12-17(20)16-19/h17,19-20H,3,5,7,9,11,15-16H2,1-2H3/t17-/m1/s1 |
| InChIKey | ITMVRZHFARFGPI-QGZVFWFLSA-N |
| XLogP | 2.07 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|