C20H32O2 — CID 11174209
[(1R,4E,6E,10E,14S)-7,11-dimethyl-4-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-1-yl]methanol (PubChem CID 11174209) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is [(1R,4E,6E,10E,14S)-7,11-dimethyl-4-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-1-yl]methanol.
| Compound Name | [(1R,4E,6E,10E,14S)-7,11-dimethyl-4-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-1-yl]methanol |
|---|---|
| PubChem CID | 11174209 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | [(1R,4E,6E,10E,14S)-7,11-dimethyl-4-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,10-trien-1-yl]methanol |
| SMILES | C/C1=C\C=C(\C(C)C)CC[C@]2(CO)O[C@H]2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H32O2/c1-15(2)18-10-8-16(3)6-5-7-17(4)9-11-19-20(14-21,22-19)13-12-18/h7-8,10,15,19,21H,5-6,9,11-14H2,1-4H3/b16-8+,17-7+,18-10+/t19-,20+/m0/s1 |
| InChIKey | UMASDLDVGGUCKS-NMRJHJCOSA-N |
| XLogP | 4.95 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|