C17H24FNOS — CID 11174338
2,6-ditert-butyl-4-(4-fluorophenyl)-6H-1,3,5-oxathiazine (PubChem CID 11174338) has the molecular formula C17H24FNOS and a molecular weight of 309.45 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(4-fluorophenyl)-6H-1,3,5-oxathiazine.
| Compound Name | 2,6-ditert-butyl-4-(4-fluorophenyl)-6H-1,3,5-oxathiazine |
|---|---|
| PubChem CID | 11174338 |
| Molecular Formula | C17H24FNOS |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2,6-ditert-butyl-4-(4-fluorophenyl)-6H-1,3,5-oxathiazine |
| SMILES | CC(C)(C)C1N=C(c2ccc(F)cc2)SC(C(C)(C)C)O1 |
| InChI | InChI=1S/C17H24FNOS/c1-16(2,3)14-19-13(11-7-9-12(18)10-8-11)21-15(20-14)17(4,5)6/h7-10,14-15H,1-6H3 |
| InChIKey | FYVVUADYJUSXKO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |