C17H28ClIN4 — CID 111743714
N-[(6-chloro-3-pyridinyl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111743714) has the molecular formula C17H28ClIN4 and a molecular weight of 450.80 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111743714 |
| Molecular Formula | C17H28ClIN4 |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N'-methyl-3-pentan-3-ylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCC(CC)C1CCN(/C(=N/C)NCc2ccc(Cl)nc2)C1.I |
| InChI | InChI=1S/C17H27ClN4.HI/c1-4-14(5-2)15-8-9-22(12-15)17(19-3)21-11-13-6-7-16(18)20-10-13;/h6-7,10,14-15H,4-5,8-9,11-12H2,1-3H3,(H,19,21);1H |
| InChIKey | LBHGNOIOFDXXIL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|