C15H20O5S — CID 11174418
(3S,4R,5R)-3-(benzenesulfonyl)-4-(2-hydroxyethyl)-5-propyloxolan-2-one (PubChem CID 11174418) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-hydroxyethyl)-5-propyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-hydroxyethyl)-5-propyloxolan-2-one |
|---|---|
| PubChem CID | 11174418 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-hydroxyethyl)-5-propyloxolan-2-one |
| SMILES | CCC[C@H]1OC(=O)[C@@H](S(=O)(=O)c2ccccc2)[C@@H]1CCO |
| InChI | InChI=1S/C15H20O5S/c1-2-6-13-12(9-10-16)14(15(17)20-13)21(18,19)11-7-4-3-5-8-11/h3-5,7-8,12-14,16H,2,6,9-10H2,1H3/t12-,13-,14+/m1/s1 |
| InChIKey | JBAQGIDTLVOAJS-MCIONIFRSA-N |
| XLogP | 1.55 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |