C11H21Cl2N2O2P — CID 11174493
(2S,4aS,8aS)-N,N-bis(2-chloroethyl)-2-oxo-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]oxazaphosphinin-2-amine (PubChem CID 11174493) has the molecular formula C11H21Cl2N2O2P and a molecular weight of 315.18 g/mol. Its IUPAC name is (2S,4aS,8aS)-N,N-bis(2-chloroethyl)-2-oxo-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]oxazaphosphinin-2-amine.
| Compound Name | (2S,4aS,8aS)-N,N-bis(2-chloroethyl)-2-oxo-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]oxazaphosphinin-2-amine |
|---|---|
| PubChem CID | 11174493 |
| Molecular Formula | C11H21Cl2N2O2P |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (2S,4aS,8aS)-N,N-bis(2-chloroethyl)-2-oxo-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3,2]oxazaphosphinin-2-amine |
| SMILES | O=[P@@]1(N(CCCl)CCCl)N[C@H]2CCCC[C@@H]2CO1 |
| InChI | InChI=1S/C11H21Cl2N2O2P/c12-5-7-15(8-6-13)18(16)14-11-4-2-1-3-10(11)9-17-18/h10-11H,1-9H2,(H,14,16)/t10-,11+,18+/m1/s1 |
| InChIKey | GHBQUJUURLHLFQ-DDBGAENHSA-N |
| XLogP | 3.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|