C20H31N3O2 — CID 111745038
N-[(2,3-dimethoxyphenyl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 111745038) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 111745038 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-N'-methyl-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | C/N=C(\NCc1cccc(OC)c1OC)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C20H31N3O2/c1-21-19(23-13-12-20(15-23)10-5-4-6-11-20)22-14-16-8-7-9-17(24-2)18(16)25-3/h7-9H,4-6,10-15H2,1-3H3,(H,21,22) |
| InChIKey | HPTLRUDLEAOCHC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|