C22H38IN3O2 — CID 111746116
N'-[(4-tert-butylphenyl)methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111746116) has the molecular formula C22H38IN3O2 and a molecular weight of 503.47 g/mol. Its IUPAC name is N'-[(4-tert-butylphenyl)methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-tert-butylphenyl)methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111746116 |
| Molecular Formula | C22H38IN3O2 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | N'-[(4-tert-butylphenyl)methyl]-N-ethyl-3-(2-methoxyethoxymethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(C)(C)C)cc1)N1CCC(COCCOC)C1.I |
| InChI | InChI=1S/C22H37N3O2.HI/c1-6-23-21(25-12-11-19(16-25)17-27-14-13-26-5)24-15-18-7-9-20(10-8-18)22(2,3)4;/h7-10,19H,6,11-17H2,1-5H3,(H,23,24);1H |
| InChIKey | MSWDNIRFWINWNH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|